On Target DRD5_HUMAN 0.27173913/CHEMBL245570
For the given ligand Xanax, we have found in our database that, being scored 0.27173913, the most similar ligand is CHEMBL245570. Check out the elaboration below.
| Xanax (Given Ligand) | CHEMBL245570 (Similar Ligand) |
|---|---|
| Cc3nnc4CN=C(c1ccccc1)c2cc(Cl)ccc2n34 | CN1CCc2ccccc2Cc3[nH]c4ccc(O)cc4c3CC1 |
|
|
|
|
|
|
| 0080800a 04040019 40200500 98010680 41000040 00880006 14800000 01201401 00000100 00080845 09010124 44008c00 02000884 00008208 80060040 000c248c 0a008800 02020205 00400000 00240000 40020000 2801a100 61000000 00400110 00802010 e00004c0 40080040 40021001 0000009c 00860c02 c0040080 a4260400 | 0000000a 00004808 20100100 51010610 00041020 00080000 06002400 01001001 04400080 000908c0 08208004 40808000 10000806 00608000 00020040 0204008c 00000200 02000005 00300400 00020200 40000000 18208008 20804000 91400010 00042000 a0000000 08120000 40000000 06000084 00060002 00040200 20012620 |