On Target TSHR_HUMAN 0.2741117/CHEMBL3964880
For the given ligand Xanax, we have found in our database that, being scored 0.2741117, the most similar ligand is CHEMBL3964880. Check out the elaboration below.
| Xanax (Given Ligand) | CHEMBL3964880 (Similar Ligand) |
|---|---|
| Cc3nnc4CN=C(c1ccccc1)c2cc(Cl)ccc2n34 | CC(=O)N1CCC(C)(c2ccccc2)c3cc(NC(=O)NCc4cccc(Cl)c4)ccc13 |
|
|
|
|
|
|
| 0080800a 04040019 40200500 98010680 41000040 00880006 14800000 01201401 00000100 00080845 09010124 44008c00 02000884 00008208 80060040 000c248c 0a008800 02020205 00400000 00240000 40020000 2801a100 61000000 00400110 00802010 e00004c0 40080040 40021001 0000009c 00860c02 c0040080 a4260400 | 0800c006 08801200 00100100 00010e00 24000020 00082040 04000004 23003001 00400800 000808d8 09380024 40008800 02008806 08100800 80020040 00040000 0004c000 02400001 08000008 00000201 c4100100 18058700 20022000 00400018 00142000 a1000000 00000010 d0001080 00488180 0006000b 00040080 a0024600 |