On Target NPFF1_HUMAN 0.27272728/CHEMBL575058
For the given ligand Xanax, we have found in our database that, being scored 0.27272728, the most similar ligand is CHEMBL575058. Check out the elaboration below.
| Xanax (Given Ligand) | CHEMBL575058 (Similar Ligand) |
|---|---|
| Cc3nnc4CN=C(c1ccccc1)c2cc(Cl)ccc2n34 | NC(=N)N\N=C(/c1ccccc1)\c2ccc(Cl)c(Cl)c2 |
|
|
|
|
|
|
| 0080800a 04040019 40200500 98010680 41000040 00880006 14800000 01201401 00000100 00080845 09010124 44008c00 02000884 00008208 80060040 000c248c 0a008800 02020205 00400000 00240000 40020000 2801a100 61000000 00400110 00802010 e00004c0 40080040 40021001 0000009c 00860c02 c0040080 a4260400 | 00008008 04000000 00000100 00010a00 00002000 00000000 04000000 81084000 00000100 000c0847 08000000 40008800 82000024 00000000 80000000 00080000 04000000 02000000 00000400 00000000 00080000 08000100 40040000 00400010 00002000 a0100800 40040100 40000000 000000a8 000e0402 40100800 00020400 |