On Target OPRD_HUMAN 0.43274853/CHEMBL212375
For the given ligand Xanax, we have found in our database that, being scored 0.43274853, the most similar ligand is CHEMBL212375. Check out the elaboration below.
| Xanax (Given Ligand) | CHEMBL212375 (Similar Ligand) |
|---|---|
| Cc3nnc4CN=C(c1ccccc1)c2cc(Cl)ccc2n34 | CN(C)Cc1nnc(c2ccc(cc2)C(C)(C)C)n1c3cccc(O)c3 |
|
|
|
|
|
|
| 0080800a 04040019 40200500 98010680 41000040 00880006 14800000 01201401 00000100 00080845 09010124 44008c00 02000884 00008208 80060040 000c248c 0a008800 02020205 00400000 00240000 40020000 2801a100 61000000 00400110 00802010 e00004c0 40080040 40021001 0000009c 00860c02 c0040080 a4260400 | 0000c002 80000008 e0000100 00010e00 01000040 00100006 22c00000 08081441 00000900 00080840 19218124 44008808 02000802 00000201 00060040 000c200c 08008000 02002024 00400000 00260400 40100001 0801a000 21800000 00404010 00000010 c0000440 10000000 00021020 00010004 00261002 84040a80 80300602 |