On Target CNR2_HUMAN 0.34951457/CHEMBL1760930
For the given ligand Xanax, we have found in our database that, being scored 0.34951457, the most similar ligand is CHEMBL1760930. Check out the elaboration below.
| Xanax (Given Ligand) | CHEMBL1760930 (Similar Ligand) |
|---|---|
| Cc3nnc4CN=C(c1ccccc1)c2cc(Cl)ccc2n34 | Clc1cccc(C(=O)c2nc(CN3CCOCC3)c4ccccn24)c1Cl |
|
|
|
|
|
|
| 0080800a 04040019 40200500 98010680 41000040 00880006 14800000 01201401 00000100 00080845 09010124 44008c00 02000884 00008208 80060040 000c248c 0a008800 02020205 00400000 00240000 40020000 2801a100 61000000 00400110 00802010 e00004c0 40080040 40021001 0000009c 00860c02 c0040080 a4260400 | 1000801a 04000800 00004500 90010e10 040410e0 00184002 0400c000 0a003001 10000100 00080858 49298044 40808800 02008886 00500000 81061448 020c018c 18028000 03000023 80200000 40000040 40000400 08028b20 33806000 00440114 00042400 c0100600 08008010 80001001 00000304 00460803 c8040000 a0020680 |