On Target CCKAR_HUMAN 0.33486238/CHEMBL9506
For the given ligand Xanax, we have found in our database that, being scored 0.33486238, the most similar ligand is CHEMBL9506. Check out the elaboration below.
| Xanax (Given Ligand) | CHEMBL9506 (Similar Ligand) |
|---|---|
| Cc3nnc4CN=C(c1ccccc1)c2cc(Cl)ccc2n34 | CN1C(=O)[C@@H](NC(=O)c2cc3ccccc3[nH]2)N=C(c4ccccc4)c5ccccc15 |
|
|
|
|
|
|
| 0080800a 04040019 40200500 98010680 41000040 00880006 14800000 01201401 00000100 00080845 09010124 44008c00 02000884 00008208 80060040 000c248c 0a008800 02020205 00400000 00240000 40020000 2801a100 61000000 00400110 00802010 e00004c0 40080040 40021001 0000009c 00860c02 c0040080 a4260400 | 0001c002 0004a800 00200120 9c010e00 52042020 00180040 10000000 03647009 00000300 00090e41 092d0024 4000a400 02008802 0550a000 00061448 021c0104 00249800 02000007 08208000 00000000 40182000 28078648 20802000 8240001e 00100080 e0000000 40000010 c50010c0 0808919c 00068003 e0044280 a0004600 |