On Target OPRX_HUMAN 0.30476192/CHEMBL466066
For the given ligand Xanax, we have found in our database that, being scored 0.30476192, the most similar ligand is CHEMBL466066. Check out the elaboration below.
| Xanax (Given Ligand) | CHEMBL466066 (Similar Ligand) |
|---|---|
| Cc3nnc4CN=C(c1ccccc1)c2cc(Cl)ccc2n34 | COc1ccc(CC2(O)CC3CCC(C2)N3C(c4ccccc4Cl)c5ccc(C)cc5Cl)nc1 |
|
|
|
|
|
|
| 0080800a 04040019 40200500 98010680 41000040 00880006 14800000 01201401 00000100 00080845 09010124 44008c00 02000884 00008208 80060040 000c248c 0a008800 02020205 00400000 00240000 40020000 2801a100 61000000 00400110 00802010 e00004c0 40080040 40021001 0000009c 00860c02 c0040080 a4260400 | 0000800a 01000008 6010510a 10010600 000c10e0 00000014 058c0000 23201000 00100900 800808c0 08308004 50858800 82000806 08a00000 81060400 020c000c 08000000 06000000 08e02008 00020201 40300d00 18008110 21800080 00508010 00002401 e0000200 08120040 d0011180 00000386 00860002 2c060000 20022600 |