On Target HRH4_HUMAN 0.3/CHEMBL4082297
For the given ligand Xanax, we have found in our database that, being scored 0.3, the most similar ligand is CHEMBL4082297. Check out the elaboration below.
| Xanax (Given Ligand) | CHEMBL4082297 (Similar Ligand) |
|---|---|
| Cc3nnc4CN=C(c1ccccc1)c2cc(Cl)ccc2n34 | CC(C)(CN=C(c1ccccc1O)c2ccccc2O)c3c[nH]cn3 |
|
|
|
|
|
|
| 0080800a 04040019 40200500 98010680 41000040 00880006 14800000 01201401 00000100 00080845 09010124 44008c00 02000884 00008208 80060040 000c248c 0a008800 02020205 00400000 00240000 40020000 2801a100 61000000 00400110 00802010 e00004c0 40080040 40021001 0000009c 00860c02 c0040080 a4260400 | 00000002 00040008 20200100 09010610 44402040 00000000 12012000 01000200 00400100 00090a41 28008010 40008800 00000002 0010a000 00060000 200c200c 00000800 0a000002 00000000 40020100 00000800 39000000 21000020 00400012 00040000 a0000200 40000000 40000000 0c00008c 00460002 42000800 20000400 |