On Target 5HT6R_HUMAN 0.2994012/CHEMBL4104479
For the given ligand Xanax, we have found in our database that, being scored 0.2994012, the most similar ligand is CHEMBL4104479. Check out the elaboration below.
| Xanax (Given Ligand) | CHEMBL4104479 (Similar Ligand) |
|---|---|
| Cc3nnc4CN=C(c1ccccc1)c2cc(Cl)ccc2n34 | CN1CCN(CC1)c2nc(N)nc(Cc3cccc(Cl)c3)n2 |
|
|
|
|
|
|
| 0080800a 04040019 40200500 98010680 41000040 00880006 14800000 01201401 00000100 00080845 09010124 44008c00 02000884 00008208 80060040 000c248c 0a008800 02020205 00400000 00240000 40020000 2801a100 61000000 00400110 00802010 e00004c0 40080040 40021001 0000009c 00860c02 c0040080 a4260400 | 00018000 04000001 00000100 04010600 07000000 00080000 04000000 04001800 00000500 000c0848 0820a000 40009800 06000006 00102000 80020000 18180004 00001800 02004001 00000000 00200000 00000000 2a40a100 60004020 02400014 00002000 80000200 00000000 00000040 0800001c 00460002 80001000 20020600 |