On Target 5HT2B_HUMAN 0.30645162/CHEMBL3601563
For the given ligand Xanax, we have found in our database that, being scored 0.30645162, the most similar ligand is CHEMBL3601563. Check out the elaboration below.
| Xanax (Given Ligand) | CHEMBL3601563 (Similar Ligand) |
|---|---|
| Cc3nnc4CN=C(c1ccccc1)c2cc(Cl)ccc2n34 | COc1ccc2c(nccc2c1OC)[C@H]3CCc4ccc(Cl)cc34 |
|
|
|
|
|
|
| 0080800a 04040019 40200500 98010680 41000040 00880006 14800000 01201401 00000100 00080845 09010124 44008c00 02000884 00008208 80060040 000c248c 0a008800 02020205 00400000 00240000 40020000 2801a100 61000000 00400110 00802010 e00004c0 40080040 40021001 0000009c 00860c02 c0040080 a4260400 | 0000800a 05000008 2000410a 10010600 00041020 00080000 070c0410 01001001 00000800 000808cc 08108004 40808800 02004826 00601000 81020041 0206808c 00000000 06000001 00300008 00020201 40000100 18008108 20804000 80440010 00002000 a0000000 00160040 40000080 02000284 0082000a 00040000 20030400 |