On Target BKRB2_HUMAN 0.29535866/CHEMBL282562
For the given ligand Xanax, we have found in our database that, being scored 0.29535866, the most similar ligand is CHEMBL282562. Check out the elaboration below.
| Xanax (Given Ligand) | CHEMBL282562 (Similar Ligand) |
|---|---|
| Cc3nnc4CN=C(c1ccccc1)c2cc(Cl)ccc2n34 | CN(C(=O)Cc1ccc(C(=O)c2ccc(NC(=O)C)cc2)n1C)c3ccc(Cl)c(COc4cccc5ccc(C)nc45)c3Cl |
|
|
|
|
|
|
| 0080800a 04040019 40200500 98010680 41000040 00880006 14800000 01201401 00000100 00080845 09010124 44008c00 02000884 00008208 80060040 000c248c 0a008800 02020205 00400000 00240000 40020000 2801a100 61000000 00400110 00802010 e00004c0 40080040 40021001 0000009c 00860c02 c0040080 a4260400 | 0400c00a 00004808 60104128 d0010600 24041020 04084024 02800000 09301000 00000100 00080ad0 08288024 40859800 03808806 08518400 41020441 020c008c 00249000 0a000005 08212000 80020000 40101000 18268728 20802000 83c5941d 00043400 e0082682 10080250 40001080 044a8284 00060043 c0047200 22020600 |