On Target HRH1_HUMAN 0.39247313/CHEMBL451
For the given ligand Xanax, we have found in our database that, being scored 0.39247313, the most similar ligand is CHEMBL451. Check out the elaboration below.
| Xanax (Given Ligand) | CHEMBL451 (Similar Ligand) |
|---|---|
| Cc3nnc4CN=C(c1ccccc1)c2cc(Cl)ccc2n34 | CNC1=Nc2ccc(Cl)cc2C(=[N+]([O-])C1)c3ccccc3 |
|
|
|
|
|
|
| 0080800a 04040019 40200500 98010680 41000040 00880006 14800000 01201401 00000100 00080845 09010124 44008c00 02000884 00008208 80060040 000c248c 0a008800 02020205 00400000 00240000 40020000 2801a100 61000000 00400110 00802010 e00004c0 40080040 40021001 0000009c 00860c02 c0040080 a4260400 | 10008002 04060010 40204100 08050600 40000000 00082200 14000410 01200000 00100100 00090c47 1a220004 40008e21 12001004 40008008 800600c1 80080019 8a000800 02000001 01004800 00080000 40000000 28010100 22000000 04c00010 00092080 a8001400 40080400 42000820 08081098 00868402 40080081 20420700 |