On Target 5HT7R_HUMAN 0.35204083/CHEMBL240888
For the given ligand Xanax, we have found in our database that, being scored 0.35204083, the most similar ligand is CHEMBL240888. Check out the elaboration below.
| Xanax (Given Ligand) | CHEMBL240888 (Similar Ligand) |
|---|---|
| Cc3nnc4CN=C(c1ccccc1)c2cc(Cl)ccc2n34 | COc1cccc(c1)C2=NCCc3c2[nH]c4ccccc34 |
|
|
|
|
|
|
| 0080800a 04040019 40200500 98010680 41000040 00880006 14800000 01201401 00000100 00080845 09010124 44008c00 02000884 00008208 80060040 000c248c 0a008800 02020205 00400000 00240000 40020000 2801a100 61000000 00400110 00802010 e00004c0 40080040 40021001 0000009c 00860c02 c0040080 a4260400 | 0000000a 42044818 20200108 59010610 40041020 00080000 12002400 11201001 00400100 00090843 08008004 40808600 10000802 2060a000 01260041 221c008c 00000800 02000007 00380400 00020300 40020000 38008008 60804000 89460012 00042000 a0000000 48000000 40000000 0e20029c 00060302 40040200 24000420 |