On Target NPY2R_HUMAN 0.009803922/CHEMBL560117
For the given ligand Aspin, we have found in our database that, being scored 0.009803922, the most similar ligand is CHEMBL560117. Check out the elaboration below.
| Aspin (Given Ligand) | CHEMBL560117 (Similar Ligand) |
|---|---|
| C=C | COc1ccccc1C(=O)N1CCN(c2ccc(NC(=O)C(C)(C)C)cc2Cl)CC1 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000400 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 0000c002 00003808 20100128 05010600 20001000 00020100 0a000000 0a001408 00000000 00110a40 08280004 40009800 02008806 00102001 01020441 00002008 00040000 12000000 08000000 00024000 40100000 38068700 20002020 0241001e 00002000 c0000400 00000800 80000080 08008300 00060001 84040000 00020200 |