On Target GASR_HUMAN 0.007246377/CHEMBL2112752
For the given ligand Aspin, we have found in our database that, being scored 0.007246377, the most similar ligand is CHEMBL2112752. Check out the elaboration below.
| Aspin (Given Ligand) | CHEMBL2112752 (Similar Ligand) |
|---|---|
| C=C | C=Cc1cccc(NC(=O)N[C@@H]2N=C(c3ccccc3)c3ccccc3N(C)C2=O)c1 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000400 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00014006 00042000 00200120 08010e00 56000024 00080040 90000084 01646409 00000300 000b0e51 082c2024 4000a400 0400a000 0910a000 00061040 00180000 00249810 02400001 08008000 00000000 40182100 28030640 20022000 0040001a 00140080 a0000000 40002010 450010c0 08489098 00068003 64004081 20004600 |