On Target NPSR1_HUMAN 0.0065789474/CHEMBL1801359
For the given ligand Aspin, we have found in our database that, being scored 0.0065789474, the most similar ligand is CHEMBL1801359. Check out the elaboration below.
| Aspin (Given Ligand) | CHEMBL1801359 (Similar Ligand) |
|---|---|
| C=C | COc1cccc2c1C(CC1CCOCC1)(c1ccc(Cl)cc1)n1ccnc1-2 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000400 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 0000c102 41800208 2010030a 10810700 a0081060 00002100 02000400 01081600 80000900 100818c0 08108008 40018840 03001866 01a00000 018200a1 020d300c 10800480 0e002000 00482000 00422201 80100120 38008110 a1005040 83500411 00002400 e0000001 00040000 50014080 06000386 0046480a 420c0800 00020400 |