On Target NK2R_HUMAN 0.013333334/CHEMBL64894
For the given ligand Aspin, we have found in our database that, being scored 0.013333334, the most similar ligand is CHEMBL64894. Check out the elaboration below.
| Aspin (Given Ligand) | CHEMBL64894 (Similar Ligand) |
|---|---|
| C=C | CN(C)c1ccc(C(=C2C=CC(=[N+](C)C)C=C2)c2ccc(N(C)C)cc2)cc1.[Cl-] |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000400 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00000002 00040800 00000100 40010200 40000000 00000001 90000080 13000402 00000020 00180843 08200004 40008001 00000000 00008000 00000042 00000004 00040d00 02000000 08000080 00000040 40002011 08000400 20008000 00400810 00000000 a0010000 40402000 40400080 00408090 08060002 04000000 01022400 |