On Target ADRB3_HUMAN 0.010526316/CHEMBL1200811
For the given ligand Aspin, we have found in our database that, being scored 0.010526316, the most similar ligand is CHEMBL1200811. Check out the elaboration below.
| Aspin (Given Ligand) | CHEMBL1200811 (Similar Ligand) |
|---|---|
| C=C | COc1ccc(C[C@@H](C)NC[C@H](O)c2ccc(O)c(NC=O)c2)cc1.O.O=C(O)/C=C/C(=O)O |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000400 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00000002 00000008 20100108 00010600 04001080 00004000 02040000 00000400 01400980 00080850 08380004 40008000 00008002 00101000 01080041 00084008 10040000 02000000 08210010 80020201 44000100 18200e20 22002000 81400010 00041000 80001000 20520040 00000080 04428200 00060003 44000000 00002600 |