On Target CCR1_HUMAN 0.010526316/CHEMBL33104
For the given ligand Aspin, we have found in our database that, being scored 0.010526316, the most similar ligand is CHEMBL33104. Check out the elaboration below.
| Aspin (Given Ligand) | CHEMBL33104 (Similar Ligand) |
|---|---|
| C=C | C=CC[N+]1(CC2CCCCCCC2)CCC(NC(=O)C2c3ccccc3Oc3ccccc32)CC1.[Br-] |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000400 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00000000 01001408 20100108 00018600 00001000 00000000 02000000 29000600 00000084 000809e0 08200000 50019080 01008002 00010000 41000001 00002008 90000000 02000100 00002000 00020201 00400000 18280610 00000000 87500018 00000000 e0000400 00080000 50200000 04000380 00060013 06022408 02002600 |