On Target MC3R_HUMAN 0.011494253/CHEMBL462044
For the given ligand Aspin, we have found in our database that, being scored 0.011494253, the most similar ligand is CHEMBL462044. Check out the elaboration below.
| Aspin (Given Ligand) | CHEMBL462044 (Similar Ligand) |
|---|---|
| C=C | C=CC[C@H]1C(=O)N([C@@H](Cc2ccc3ccccc3c2)C(=O)NC)CCN1C(=O)[C@H](N)Cc1ccc(F)cc1 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000400 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00000000 08003200 00100100 06010600 00000000 00000010 00080000 2000040c 10000880 001808c8 08300000 4000b000 06008002 00003001 80000000 00040000 00004000 02000080 40000008 00100201 00000100 38200608 00000023 83400018 00000800 80000000 00000000 90000001 0c000000 8006800b 24004000 00002600 |