On Target 5HT5A_HUMAN 0.010638298/CHEMBL188486
For the given ligand Aspin, we have found in our database that, being scored 0.010638298, the most similar ligand is CHEMBL188486. Check out the elaboration below.
| Aspin (Given Ligand) | CHEMBL188486 (Similar Ligand) |
|---|---|
| C=C | CN(C)CCN(Cc1ccc(-c2ccc(CNCCc3ccccc3)cc2)cc1)C(=O)/C=C/c1ccccc1.O=C(O)C(F)(F)F |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000400 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00002000 0080a000 00100100 04010600 00000000 00000000 80100080 02001408 01800180 00490840 08200000 40008000 80008802 00012000 00000402 00080008 20020400 02000100 04018000 10801204 80000000 38208e00 10000000 83400018 00000000 c0000000 00482200 d0010040 0c404100 00060003 24040000 00000600 |