On Target GRM7_HUMAN 0.0070422534/CHEMBL4168668
For the given ligand Aspin, we have found in our database that, being scored 0.0070422534, the most similar ligand is CHEMBL4168668. Check out the elaboration below.
| Aspin (Given Ligand) | CHEMBL4168668 (Similar Ligand) |
|---|---|
| C=C | COc1cc(F)c(-c2c(C)nn3c(C(F)(F)F)cc(C)nc23)c(F)c1 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000400 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00000022 40000809 60100188 1a050610 01005024 0400401e 02841400 00200c00 00006100 01018870 0c000004 c0018802 80000816 08309000 21120801 800c200c 00268a40 02800000 04400000 00221000 00000000 0c00a000 20800840 80400100 00142401 c1080000 28020200 90000851 00004204 00428003 402000b0 000052a0 |