On Target ADA2B_HUMAN 0.014925373/CHEMBL196
For the given ligand Aspin, we have found in our database that, being scored 0.014925373, the most similar ligand is CHEMBL196. Check out the elaboration below.
| Aspin (Given Ligand) | CHEMBL196 (Similar Ligand) |
|---|---|
| C=C | O=C1O[C@H]([C@@H](O)CO)C(O)=C1O |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000400 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00040008 80000000 00000500 10010200 00600040 00000000 02000280 28001400 01000000 01500000 00000200 4000c000 88028000 00000000 00000004 000a8008 00020010 00000000 01450010 00002001 00000020 00000a80 05008000 08000010 00001400 00000400 00400000 80000020 00014200 00000008 14000000 00800010 |