On Target MSHR_HUMAN 0.007352941/CHEMBL185868
For the given ligand Aspin, we have found in our database that, being scored 0.007352941, the most similar ligand is CHEMBL185868. Check out the elaboration below.
| Aspin (Given Ligand) | CHEMBL185868 (Similar Ligand) |
|---|---|
| C=C | C=CCC(=O)N[C@@H](Cc1ccc(Cl)cc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(N)=O |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000400 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00018002 09003a00 00100100 45810e10 00041200 00000000 00082000 2000240c 00600ac0 001908ca 08300004 4003b800 1e009836 00402801 80000040 00140004 00000000 02000000 00200408 00000201 40000100 38258728 20800003 93500018 00043800 80000000 48040000 10000000 0c000010 0006000b a40c4200 00022620 |