On Target 5HT1F_HUMAN 0.011363637/CHEMBL125745
For the given ligand Aspin, we have found in our database that, being scored 0.011363637, the most similar ligand is CHEMBL125745. Check out the elaboration below.
| Aspin (Given Ligand) | CHEMBL125745 (Similar Ligand) |
|---|---|
| C=C | NCCc1cccc2c1ccn2S(=O)(=O)c1ccccc1 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000400 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00000012 00804800 21002100 40b10640 00060000 00000000 40000000 00000400 00000000 00080840 08002004 60008000 90001802 00440001 84200041 00040004 00000000 02000104 00600000 00022000 c0000000 18008008 a0800050 89400018 00802000 80000000 20000040 00000008 04404000 20060022 00040200 00010420 |