On Target NPBW1_HUMAN 0.007352941/CHEMBL2314324
For the given ligand Aspin, we have found in our database that, being scored 0.007352941, the most similar ligand is CHEMBL2314324. Check out the elaboration below.
| Aspin (Given Ligand) | CHEMBL2314324 (Similar Ligand) |
|---|---|
| C=C | COc1ccc(Oc2c(Cl)cnn(Cc3c(OC)ccc4ccccc34)c2=O)cc1 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000400 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00010004 00000608 60000108 00010600 00081058 00008108 42048000 0000b400 06100000 800008c0 00002008 78858800 0600980e 02e00000 01040001 010d200c 18040c08 02004028 00202110 40260000 00400000 1c018318 21800881 83700000 04107040 80008c00 00088000 00240000 04000300 00060008 80040401 02c20000 |