On Target CLTR1_HUMAN 0.009259259/CHEMBL11793
For the given ligand Aspin, we have found in our database that, being scored 0.009259259, the most similar ligand is CHEMBL11793. Check out the elaboration below.
| Aspin (Given Ligand) | CHEMBL11793 (Similar Ligand) |
|---|---|
| C=C | N#Cc1ccc(O)c(C(=O)/C=C/c2cccc(/C=C/c3ccc4ccccc4n3)c2)c1 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000400 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00000002 00000808 20004304 10010e02 00040021 00820000 82000081 08000608 01840000 00b80840 08000104 40008000 00008822 00400000 80020042 0a0c200c 00400400 02100004 00a18000 00022800 40000000 18028208 20808400 80418014 01000000 82000001 00422040 40000200 00404004 00260402 84040000 00000400 |