On Target NPY5R_HUMAN 0.0088495575/CHEMBL3084889
For the given ligand Aspin, we have found in our database that, being scored 0.0088495575, the most similar ligand is CHEMBL3084889. Check out the elaboration below.
| Aspin (Given Ligand) | CHEMBL3084889 (Similar Ligand) |
|---|---|
| C=C | C=CCC1c2ccc(O)cc2CCC1NC[C@H]1CC[C@H](CNS(=O)(=O)c2ccccc2)CC1 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000400 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00000010 43800208 21100102 01b10600 00080020 40000002 02000000 20000401 10000880 005808c2 08302000 60818000 00000002 00200001 80600400 02040008 00006200 02000000 02402000 00026601 80000100 18200010 00004000 99540018 02000000 80000005 00120000 9000000c 04000402 2006000a 24020000 00012670 |