On Target CXCR1_HUMAN 0.008064516/CHEMBL464302
For the given ligand Aspin, we have found in our database that, being scored 0.008064516, the most similar ligand is CHEMBL464302. Check out the elaboration below.
| Aspin (Given Ligand) | CHEMBL464302 (Similar Ligand) |
|---|---|
| C=C | C[C@H](Nc1nsnc1Nc1cccc(C(=O)N(C)C)c1O)C(C)(C)C |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000400 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 10010002 00010888 20100101 01010620 20000000 08020010 02000010 0a101600 00803100 00080851 80252004 40008880 0a008812 00100001 00040041 100c600c 00040000 1a005000 08000012 10024001 41100000 18228f00 21000010 00410015 00040002 80800400 20000000 80000090 20408108 10060001 c6041000 00010200 |