On Target DRD1_HUMAN 0.015873017/CHEMBL534678
For the given ligand Aspin, we have found in our database that, being scored 0.015873017, the most similar ligand is CHEMBL534678. Check out the elaboration below.
| Aspin (Given Ligand) | CHEMBL534678 (Similar Ligand) |
|---|---|
| C=C | C=CCN1CCc2ccc(O)cc2C(c2ccccc2)C1.Cl |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000400 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00000000 42000008 20100100 00010600 00000020 80000000 02000400 01000401 00000080 00080840 08200000 40808000 00000002 00210000 00000000 00000008 00000200 02100100 00100000 00020200 00000000 18200000 00004000 81420010 00000000 a0000000 001a0000 40000000 06000080 00060002 04000000 02022600 |