On Target TSHR_HUMAN 0.007352941/CHEMBL1515891
For the given ligand Aspin, we have found in our database that, being scored 0.007352941, the most similar ligand is CHEMBL1515891. Check out the elaboration below.
| Aspin (Given Ligand) | CHEMBL1515891 (Similar Ligand) |
|---|---|
| C=C | COc1ccc(C2Nc3cccc(O)c3C(=O)N2Cc2ccccc2)cc1COc1ccc(NC(C)=O)cc1 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000400 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 14004006 80800808 20000108 00010e00 00001001 40134042 12040004 02003c09 00800100 20300840 41280004 4000c000 00808822 00110000 01020441 02082008 00046980 03400022 08000000 40822c01 c0100100 08038620 20032000 00c4101c 00100000 c0002000 08260000 80001080 00008300 00060001 c4044004 c0004201 |