On Target NPFF1_HUMAN 0.008928572/CHEMBL2208303
For the given ligand Aspin, we have found in our database that, being scored 0.008928572, the most similar ligand is CHEMBL2208303. Check out the elaboration below.
| Aspin (Given Ligand) | CHEMBL2208303 (Similar Ligand) |
|---|---|
| C=C | N=C(N)NCCC[C@@H](NC(=O)/C=C/c1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(N)=O |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000400 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00010000 0100b200 00100100 04010e00 00000000 00000000 80100080 2000240c 01a00a80 004808c2 08300800 4003b000 06009012 00012001 80000002 00100000 20000400 02000100 00018008 00801201 00000100 38250620 00000003 83500018 00000800 80000000 40482000 50010000 0c400010 0006000b a4084000 02002600 |