On Target 5HT1B_HUMAN 0.012820513/CHEMBL3752900
For the given ligand Aspin, we have found in our database that, being scored 0.012820513, the most similar ligand is CHEMBL3752900. Check out the elaboration below.
| Aspin (Given Ligand) | CHEMBL3752900 (Similar Ligand) |
|---|---|
| C=C | C=CCN(CC=C)CCc1c[nH]c2ccc(Cl)cc12 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000400 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00008002 00000800 00100100 41010610 00041000 00000000 00002000 00000400 00400080 00090840 08200004 40008800 1200082e 00410000 00000040 00040004 00000000 02000100 00200400 00000200 40000000 18208108 20800000 91400010 00046000 80000000 080c0000 00000020 04000000 00060002 04040200 02020620 |