On Target CCKAR_HUMAN 0.0056818184/CHEMBL479063
For the given ligand Aspin, we have found in our database that, being scored 0.0056818184, the most similar ligand is CHEMBL479063. Check out the elaboration below.
| Aspin (Given Ligand) | CHEMBL479063 (Similar Ligand) |
|---|---|
| C=C | COc1cccc(-c2cc(C(=O)N3CCN(c4cccc(Cl)c4)CC3)nn2-c2ccc(C)cc2)c1 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000400 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 0000e006 40003a08 a0080128 05050e00 01081000 04004002 1a440000 00003408 00000904 40110ac0 09310024 60108808 82008816 00202201 01000441 080c200c 000600c0 02801000 8c480000 00227200 40100000 3807a720 b0800820 8340400e 00206010 c0000040 18220000 800008e1 1c00c304 00460009 c40e9200 800207a2 |