On Target GRM8_HUMAN 0.00625/CHEMBL4446107
For the given ligand Aspin, we have found in our database that, being scored 0.00625, the most similar ligand is CHEMBL4446107. Check out the elaboration below.
| Aspin (Given Ligand) | CHEMBL4446107 (Similar Ligand) |
|---|---|
| C=C | CCc1nn2c(C(F)(F)F)cc(C)nc2c1-c1cc(F)c(OC)cc1F |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000400 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00000022 40000809 60100188 5a050610 01005024 0400401e 02841400 00200e00 04006100 010ca870 0c108004 52018802 80008816 08309000 21120801 800c200c 00268a40 02800000 04400000 00a21040 00000000 2c40a200 20804840 80400110 00942401 c1080000 28120200 90000851 00004204 00428003 402000b0 000052a0 |