On Target 5HT2C_HUMAN 0.01754386/CHEMBL202324
For the given ligand Aspin, we have found in our database that, being scored 0.01754386, the most similar ligand is CHEMBL202324. Check out the elaboration below.
| Aspin (Given Ligand) | CHEMBL202324 (Similar Ligand) |
|---|---|
| C=C | C=CCN[C@@H](C)Cn1ccc2ccc3ncccc3c21 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000400 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00000002 00800400 00004000 40000600 000c0000 00000000 00000000 00000400 00200000 000008c0 00200004 40018000 00000802 00c10000 000008c0 00040004 00000000 00000100 00600000 00001000 40000000 38008018 20800040 82000010 08000000 80000000 00080000 00000000 08000000 00060010 04040200 00000200 |