On Target GRM4_HUMAN 0.013513514/CHEMBL1209438
For the given ligand Aspin, we have found in our database that, being scored 0.013513514, the most similar ligand is CHEMBL1209438. Check out the elaboration below.
| Aspin (Given Ligand) | CHEMBL1209438 (Similar Ligand) |
|---|---|
| C=C | Cc1cc(/C=C/c2ccccc2)nc(N)n1 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000400 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00000042 00000800 00000100 00050e00 01000004 00004000 c0002080 08000400 00000100 00000840 00000104 40008800 00000000 00100000 80020002 000c000c 00000400 02000000 00420000 00200000 00000000 1e000000 20a00840 00410100 00000000 83000001 00402001 40000200 0041400c 00660000 44000000 000020a0 |