On Target BKRB2_HUMAN 0.007874016/CHEMBL1162797
For the given ligand Aspin, we have found in our database that, being scored 0.007874016, the most similar ligand is CHEMBL1162797. Check out the elaboration below.
| Aspin (Given Ligand) | CHEMBL1162797 (Similar Ligand) |
|---|---|
| C=C | CCCC[PH](CCCC)(CCCC)Cc1ccc(/C=C\[C@H](Cc2ccc3ccccc3c2)N/C(=N/C2CCCCC2)NC2CCCCC2)cc1.Cl.Cl |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000400 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00000040 01008200 00100300 00110e00 00040040 00200000 80010084 24002400 00000f00 015808c2 18300011 40118000 00021600 00010008 02010002 00100000 22009c08 02000500 02102040 00800201 01002100 38210018 00008021 a3500011 01010000 80010002 40412000 d0010000 0e400210 00060302 94080000 0003c600 |