On Target HRH1_HUMAN 0.01724138/CHEMBL3983211
For the given ligand Aspin, we have found in our database that, being scored 0.01724138, the most similar ligand is CHEMBL3983211. Check out the elaboration below.
| Aspin (Given Ligand) | CHEMBL3983211 (Similar Ligand) |
|---|---|
| C=C | CN1CCC(Oc2ccccc2)CC1.O=C(O)/C=C/C(=O)O |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000400 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 04000000 01000008 20100108 00010600 00001000 02000000 02000000 00000400 01000000 000008c0 00200000 50018000 00808002 00000000 01000001 00082008 00200000 00000000 00a10010 00020201 00000000 18000a00 01000080 00100010 00001001 00001000 00400000 10000000 00000200 00060000 04000000 00000240 |