On Target 5HT1A_HUMAN 0.015384615/CHEMBL286006
For the given ligand Aspin, we have found in our database that, being scored 0.015384615, the most similar ligand is CHEMBL286006. Check out the elaboration below.
| Aspin (Given Ligand) | CHEMBL286006 (Similar Ligand) |
|---|---|
| C=C | C=CCN1CC[C@@H]2c3ccccc3CC[C@H]21 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000400 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00000000 01000200 00100102 00010600 00000020 00000012 00000000 20000401 00000880 000808c0 08300000 40818000 00000002 00210000 00000000 02040000 00000200 02000100 00002000 00000201 00000100 18200010 00004000 81500010 00000000 80000001 00080000 10000000 04000002 0006000a 04020000 02002600 |