On Target CXCR2_HUMAN 0.011494253/CHEMBL535818
For the given ligand Aspin, we have found in our database that, being scored 0.011494253, the most similar ligand is CHEMBL535818. Check out the elaboration below.
| Aspin (Given Ligand) | CHEMBL535818 (Similar Ligand) |
|---|---|
| C=C | Cl.NCc1c(Cl)ccc(NC(=O)Nc2ccccc2Br)c1O |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000400 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 0000c006 04008008 20000100 00010e40 04000000 08000000 12000000 00003401 00820000 00000850 00280004 40008800 02008816 08100002 80000040 00006008 00040000 0a000000 08000000 00020001 40000900 08008500 20022000 00490000 00142000 80000200 200a0040 00000080 00408000 00060001 00040008 0a024000 |