On Target EDNRA_HUMAN 0.051282052/CHEMBL405599
For the given ligand CN(C)C(=N)/N=C(N)/N, we have found in our database that, being scored 0.051282052, the most similar ligand is CHEMBL405599. Check out the elaboration below.
| CN(C)C(=N)/N=C(N)/N (Given Ligand) | CHEMBL405599 (Similar Ligand) |
|---|---|
| CN(C)C(=N)/N=C(N)\N | CC[C@H](C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H](NC(C)=O)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)[C@@H](C)CC |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000800 02000000 00000000 00000000 00002000 00000000 00000002 00200020 00000000 00000000 00000008 00001000 00000000 00000800 00000000 00000000 00000000 00000000 00000800 00000000 00000000 00000010 00010000 40000000 00000000 00000010 00040000 00000000 00000000 | 00070002 01007a00 00100100 45810e10 00141080 00000000 00002000 2100200c 00600a80 000908c2 08300004 4003b000 1e009812 00402801 80180040 001c000c 10000000 02000001 00e00418 00000201 40000100 38358e28 238000c3 93500018 00043801 a0000000 48000000 50000000 0c000092 0006000b a00c4200 00802e20 |