On Target 5HT1D_HUMAN 0.13043478/CHEMBL182837
For the given ligand CN(C)C(=N)/N=C(N)/N, we have found in our database that, being scored 0.13043478, the most similar ligand is CHEMBL182837. Check out the elaboration below.
| CN(C)C(=N)/N=C(N)/N (Given Ligand) | CHEMBL182837 (Similar Ligand) |
|---|---|
| CN(C)C(=N)/N=C(N)\N | Cc1cc(Br)cc(C)c1N=C1NCCN1 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000800 02000000 00000000 00000000 00002000 00000000 00000002 00200020 00000000 00000000 00000008 00001000 00000000 00000800 00000000 00000000 00000000 00000000 00000800 00000000 00000000 00000010 00010000 40000000 00000000 00000010 00040000 00000000 00000000 | 000040c2 00008000 00000100 00010e00 00000001 00000000 00000000 00002000 40000400 00000842 10200004 c4008220 00000010 40000008 000200c0 00100088 00000800 02002000 01000000 00000000 40000100 28010000 22000000 00400000 00080000 88000000 40220000 00000800 08000010 00860000 00000008 08000300 |