On Target OPRM_HUMAN 0.09859155/CHEMBL147949
For the given ligand CN(C)C(=N)/N=C(N)/N, we have found in our database that, being scored 0.09859155, the most similar ligand is CHEMBL147949. Check out the elaboration below.
| CN(C)C(=N)/N=C(N)/N (Given Ligand) | CHEMBL147949 (Similar Ligand) |
|---|---|
| CN(C)C(=N)/N=C(N)\N | CCC(=O)N(CCCN=C(N)N)C1CCN(CCc2ccccc2)CC1 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000800 02000000 00000000 00000000 00002000 00000000 00000002 00200020 00000000 00000000 00000008 00001000 00000000 00000800 00000000 00000000 00000000 00000000 00000800 00000000 00000000 00000010 00010000 40000000 00000000 00000010 00040000 00000000 00000000 | 00000000 01001400 00100100 00010e00 00000000 00000000 00010000 20000000 00000080 000a09e2 08200010 50019000 00008002 00000008 00000000 00000000 00000800 02000000 00000000 00000201 00000000 38280600 00000000 81500018 00000000 80000000 40030000 10000000 0c000000 00060013 00000000 00002600 |