On Target OPRK_HUMAN 0.12328767/CHEMBL435414
For the given ligand CN(C)C(=N)/N=C(N)/N, we have found in our database that, being scored 0.12328767, the most similar ligand is CHEMBL435414. Check out the elaboration below.
| CN(C)C(=N)/N=C(N)/N (Given Ligand) | CHEMBL435414 (Similar Ligand) |
|---|---|
| CN(C)C(=N)/N=C(N)\N | CC1CCC(CN2C3=NC[C@H](C4CCCCC4)N3C[C@@H]2C2CCCCC2)CC1 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000800 02000000 00000000 00000000 00002000 00000000 00000002 00200020 00000000 00000000 00000008 00001000 00000000 00000800 00000000 00000000 00000000 00000000 00000800 00000000 00000000 00000010 00010000 40000000 00000000 00000010 00040000 00000000 00000000 | 00000040 01000000 00100040 04000c00 00000000 00000000 00030004 20002000 00000600 00020482 10200010 40010000 00003402 00002008 00000000 00100080 00010800 00002000 02102040 00000201 00202100 30010010 00000003 02100010 00010080 00000000 40010000 10000000 0a000010 00040000 800a0100 00002200 |