On Target CLTR1_HUMAN 0.03797468/CHEMBL3403185
For the given ligand CN(C)C(=N)/N=C(N)/N, we have found in our database that, being scored 0.03797468, the most similar ligand is CHEMBL3403185. Check out the elaboration below.
| CN(C)C(=N)/N=C(N)/N (Given Ligand) | CHEMBL3403185 (Similar Ligand) |
|---|---|
| CN(C)C(=N)/N=C(N)\N | O=C(O)CCCN1CC(c2nnn[nH]2)Oc2c(CCc3ccc(OCCCCc4ccccc4)cc3)cccc21 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000800 02000000 00000000 00000000 00002000 00000000 00000002 00200020 00000000 00000000 00000008 00001000 00000000 00000800 00000000 00000000 00000000 00000000 00000800 00000000 00000000 00000010 00010000 40000000 00000000 00000010 00040000 00000000 00000000 | 04026002 01000018 6032110a 00010702 b0181080 82002048 02040000 20082200 00400a00 000808d0 08348004 400090c0 04808082 00204800 110a1041 0008600e d0850800 0a028800 08442000 00020201 45160100 18140a00 b3400000 00408410 00040000 c0000000 28120000 10000081 00408304 00060002 80000400 08802f00 |