On Target GRM1_HUMAN 0.09/CHEMBL239800
For the given ligand CN(C)C(=N)/N=C(N)/N, we have found in our database that, being scored 0.09, the most similar ligand is CHEMBL239800. Check out the elaboration below.
| CN(C)C(=N)/N=C(N)/N (Given Ligand) | CHEMBL239800 (Similar Ligand) |
|---|---|
| CN(C)C(=N)/N=C(N)\N | CN1CC(=O)N=C1NC(=O)Nc1cccc(Cl)c1 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000800 02000000 00000000 00000000 00002000 00000000 00000002 00200020 00000000 00000000 00000008 00001000 00000000 00000800 00000000 00000000 00000000 00000000 00000800 00000000 00000000 00000010 00010000 40000000 00000000 00000010 00040000 00000000 00000000 | 00018006 01000000 00000000 02000e00 00000000 00080000 08020004 40002001 00000040 00120c42 12280016 4000a800 0600a006 00100009 00000040 00300000 00040800 00000000 08000000 00004001 40210100 28030700 2002a000 00002010 00102080 00000000 40401001 20000080 0b009010 00060001 04004101 00034200 |