On Target DRD5_HUMAN 0.053435113/CHEMBL42
For the given ligand CN(C)C(=N)/N=C(N)/N, we have found in our database that, being scored 0.053435113, the most similar ligand is CHEMBL42. Check out the elaboration below.
| CN(C)C(=N)/N=C(N)/N (Given Ligand) | CHEMBL42 (Similar Ligand) |
|---|---|
| CN(C)C(=N)/N=C(N)\N | CN1CCN(C2=Nc3cc(Cl)ccc3Nc3ccccc32)CC1 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000800 02000000 00000000 00000000 00002000 00000000 00000002 00200020 00000000 00000000 00000008 00001000 00000000 00000800 00000000 00000000 00000000 00000000 00000800 00000000 00000000 00000010 00010000 40000000 00000000 00000010 00040000 00000000 00000000 | 00008246 00040000 00100100 0c010600 00000001 80100000 18000010 02001040 00002500 0001c843 10200004 44008c30 02000806 c000a009 040604c0 18180080 04050808 13004002 09000002 10800000 40000000 28008100 23000020 02400000 00082000 c8000100 42080400 91011880 08088118 00a60000 40040001 42020200 |