On Target GRM2_HUMAN 0.055555556/CHEMBL468800
For the given ligand CN(C)C(=N)/N=C(N)/N, we have found in our database that, being scored 0.055555556, the most similar ligand is CHEMBL468800. Check out the elaboration below.
| CN(C)C(=N)/N=C(N)/N (Given Ligand) | CHEMBL468800 (Similar Ligand) |
|---|---|
| CN(C)C(=N)/N=C(N)\N | N[C@@H](C(=O)O)[C@H]1[C@H](CNC(=O)Nc2ccccc2)[C@H]1C(=O)O |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000800 02000000 00000000 00000000 00002000 00000000 00000002 00200020 00000000 00000000 00000008 00001000 00000000 00000800 00000000 00000000 00000000 00000000 00000800 00000000 00000000 00000010 00010000 40000000 00000000 00000010 00040000 00000000 00000000 | 00030006 01001000 00100000 00000e00 00180000 00000000 00000004 00002001 00200000 000208c0 00280004 4003b000 04009038 03900000 00000040 00080008 00040000 00400000 08402000 00000001 40000100 18050e30 23022000 00100018 00110000 00000000 00000000 10000080 00008000 00060001 00080000 00804a00 |