On Target CNR2_HUMAN 0.08737864/CHEMBL515604
For the given ligand CN(C)C(=N)/N=C(N)/N, we have found in our database that, being scored 0.08737864, the most similar ligand is CHEMBL515604. Check out the elaboration below.
| CN(C)C(=N)/N=C(N)/N (Given Ligand) | CHEMBL515604 (Similar Ligand) |
|---|---|
| CN(C)C(=N)/N=C(N)\N | CSC(=O)N1CC2(CCCCC2)CN/C1=N\c1cccc2ccccc12 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000800 02000000 00000000 00000000 00002000 00000000 00000002 00200020 00000000 00000000 00000008 00001000 00000000 00000800 00000000 00000000 00000000 00000000 00000800 00000000 00000000 00000010 00010000 40000000 00000000 00000010 00040000 00000000 00000000 | 00000042 81001000 0010c000 00100e04 00020004 00100000 00000004 00002000 00000200 800009e3 10200004 44018020 0100b000 400c0008 000000c0 00100000 04000830 01000200 03002000 00000009 40012100 180d0418 22000000 00100018 000b0000 08000000 40400000 10000800 00002010 00860011 800a0012 40010200 |